Useful Links & Tools
- MSDS
- Specification Sheet
- Certificate of Analysis
- Certificate of Origin
- Bulk Quote
- Similar Products
Last 5 Products Viewed
W239402
Aldrich
α,α-Dimethylphenethyl butyrate
≥95%, Kosher, FCC
| CAS Number: | 10094-34-5 |
| Linear Formula: | CH3CH2CH2CO2C(CH3)2CH2C6H5 |
| Molecular Weight: | 220.31 |
| FEMA Number: | 2394 |
| EC Number: | 233-221-8 |
| Council of Europe no.: | 2084 |
| MDL number: | MFCD00027132 |
| PubChem Substance ID: | 24901043 |
| Flavis number: | 9.232 |
Description
| F&F Certificates | EU Natural Certificate |
| HALAL Statement | |
| Allergen Statement | |
| US Natural Certificate | |
| Continuing Guarantee Statement | |
| GMO Statement |
Properties
| grade | FCC |
| Halal | |
| Kosher | |
| assay | ≥95% |
| refractive index | n |
| bp | 237-255 °C(lit.) |
| density | 0.969 g/mL at 25 °C(lit.) |
| Organoleptic | herbaceous; plum |
Safety
| Personal Protective Equipment | Eyeshields, Faceshields, full-face respirator (US), Gloves, multi-purpose combination respirator cartridge (US), type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 38-43-51/53 |
| Safety Statements | 36/37-61 |
| RIDADR | UN3082 9/PG 3 |
| WGK Germany | 2 |
| RTECS | ET0130000 |
| Flash Point(F) | 230 °F |
| Flash Point(C) | 110 °C |
References
| reference | Arctander, 992 / Fenaroli, 188 |






